C22H17ClN4S2 — CID 151224506
5-(2-chlorophenyl)-1,5-diphenyl-2,6-dihydro-1H-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dithione (PubChem CID 151224506) has the molecular formula C22H17ClN4S2 and a molecular weight of 436.99 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-1,5-diphenyl-2,6-dihydro-1H-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dithione.
| Compound Name | 5-(2-chlorophenyl)-1,5-diphenyl-2,6-dihydro-1H-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dithione |
|---|---|
| PubChem CID | 151224506 |
| Molecular Formula | C22H17ClN4S2 |
| Molecular Weight | 436.99 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | 5-(2-chlorophenyl)-1,5-diphenyl-2,6-dihydro-1H-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dithione |
| SMILES | S=C1NC(c2ccccc2)(c2ccccc2Cl)N2C(=S)NC(c3ccccc3)N12 |
| InChI | InChI=1S/C22H17ClN4S2/c23-18-14-8-7-13-17(18)22(16-11-5-2-6-12-16)25-21(29)26-19(24-20(28)27(22)26)15-9-3-1-4-10-15/h1-14,19H,(H,24,28)(H,25,29) |
| InChIKey | NMZGWSYHYWBXHM-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.99 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|