About butan-2-amine;butan-2-ylcarbamic acid
butan-2-amine;butan-2-ylcarbamic acid (PubChem CID 15122513) has the molecular formula C9H22N2O2
and a molecular weight of 190.29 g/mol. Its IUPAC name is butan-2-amine;butan-2-ylcarbamic acid.
Molecular Properties
| Compound Name | butan-2-amine;butan-2-ylcarbamic acid |
| PubChem CID | 15122513 |
| Molecular Formula | C9H22N2O2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | butan-2-amine;butan-2-ylcarbamic acid |
| SMILES | CCC(C)N.CCC(C)NC(=O)O |
| InChI | InChI=1S/C5H11NO2.C4H11N/c1-3-4(2)6-5(7)8;1-3-4(2)5/h4,6H,3H2,1-2H3,(H,7,8);4H,3,5H2,1-2H3 |
| InChIKey | NSADEYWZPTXRIY-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butan-2-amine;butan-2-ylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-amine;butan-2-ylcarbamic acid?
The IUPAC name of butan-2-amine;butan-2-ylcarbamic acid (CID 15122513) is butan-2-amine;butan-2-ylcarbamic acid.
What is the SMILES notation for butan-2-amine;butan-2-ylcarbamic acid?
The canonical SMILES for butan-2-amine;butan-2-ylcarbamic acid is CCC(C)N.CCC(C)NC(=O)O.
What is the InChIKey of butan-2-amine;butan-2-ylcarbamic acid?
The InChIKey is NSADEYWZPTXRIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2.C4H11N/c1-3-4(2)6-5(7)8;1-3-4(2)5/h4,6H,3H2,1-2H3,(H,7,8);4H,3,5H2,1-2H3.
What are the key properties of butan-2-amine;butan-2-ylcarbamic acid?
butan-2-amine;butan-2-ylcarbamic acid has a molecular weight of 190.29 g/mol, XLogP of 1.80, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-amine;butan-2-ylcarbamic acid is sourced from PubChem (CID 15122513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).