piperidine;piperidine-1-carboxylic acid

C11H22N2O2 — CID 15122514

IUPACpiperidine;piperidine-1-carboxylic acid
SMILESC1CCNCC1.O=C(O)N1CCCCC1
InChIInChI=1S/C6H11NO2.C5H11N/c8-6(9)7-4-2-1-3-5-7;1-2-4-6-5-3-1/h1-5H2,(H,8,9);6H,1-5H2
InChIKeyUIRIZJBIXWLVER-UHFFFAOYSA-N
MW214.31 g/mol
LogP1.91
Rot. Bonds

About piperidine;piperidine-1-carboxylic acid

piperidine;piperidine-1-carboxylic acid (PubChem CID 15122514) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is piperidine;piperidine-1-carboxylic acid.

Molecular Properties

Compound Namepiperidine;piperidine-1-carboxylic acid
PubChem CID15122514
Molecular FormulaC11H22N2O2
Molecular Weight214.31 g/mol
Exact Mass214.17
IUPAC Namepiperidine;piperidine-1-carboxylic acid
SMILESC1CCNCC1.O=C(O)N1CCCCC1
InChIInChI=1S/C6H11NO2.C5H11N/c8-6(9)7-4-2-1-3-5-7;1-2-4-6-5-3-1/h1-5H2,(H,8,9);6H,1-5H2
InChIKeyUIRIZJBIXWLVER-UHFFFAOYSA-N
XLogP1.91
TPSA52.57 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.31
LogP ≤ 51.91
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze piperidine;piperidine-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of piperidine;piperidine-1-carboxylic acid?
The IUPAC name of piperidine;piperidine-1-carboxylic acid (CID 15122514) is piperidine;piperidine-1-carboxylic acid.
What is the SMILES notation for piperidine;piperidine-1-carboxylic acid?
The canonical SMILES for piperidine;piperidine-1-carboxylic acid is C1CCNCC1.O=C(O)N1CCCCC1.
What is the InChIKey of piperidine;piperidine-1-carboxylic acid?
The InChIKey is UIRIZJBIXWLVER-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2.C5H11N/c8-6(9)7-4-2-1-3-5-7;1-2-4-6-5-3-1/h1-5H2,(H,8,9);6H,1-5H2.
What are the key properties of piperidine;piperidine-1-carboxylic acid?
piperidine;piperidine-1-carboxylic acid has a molecular weight of 214.31 g/mol, XLogP of 1.91, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for piperidine;piperidine-1-carboxylic acid is sourced from PubChem (CID 15122514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).