About 4-tert-butyl-1,2-dihydro-3-benzothiepine
4-tert-butyl-1,2-dihydro-3-benzothiepine (PubChem CID 15122704) has the molecular formula C14H18S
and a molecular weight of 218.36 g/mol. Its IUPAC name is 4-tert-butyl-1,2-dihydro-3-benzothiepine.
Molecular Properties
| Compound Name | 4-tert-butyl-1,2-dihydro-3-benzothiepine |
| PubChem CID | 15122704 |
| Molecular Formula | C14H18S |
| Molecular Weight | 218.36 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 4-tert-butyl-1,2-dihydro-3-benzothiepine |
| SMILES | CC(C)(C)C1=Cc2ccccc2CCS1 |
| InChI | InChI=1S/C14H18S/c1-14(2,3)13-10-12-7-5-4-6-11(12)8-9-15-13/h4-7,10H,8-9H2,1-3H3 |
| InChIKey | CRFOLFGZVPLQOG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.36 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-tert-butyl-1,2-dihydro-3-benzothiepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-1,2-dihydro-3-benzothiepine?
The IUPAC name of 4-tert-butyl-1,2-dihydro-3-benzothiepine (CID 15122704) is 4-tert-butyl-1,2-dihydro-3-benzothiepine.
What is the SMILES notation for 4-tert-butyl-1,2-dihydro-3-benzothiepine?
The canonical SMILES for 4-tert-butyl-1,2-dihydro-3-benzothiepine is CC(C)(C)C1=Cc2ccccc2CCS1.
What is the InChIKey of 4-tert-butyl-1,2-dihydro-3-benzothiepine?
The InChIKey is CRFOLFGZVPLQOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18S/c1-14(2,3)13-10-12-7-5-4-6-11(12)8-9-15-13/h4-7,10H,8-9H2,1-3H3.
What are the key properties of 4-tert-butyl-1,2-dihydro-3-benzothiepine?
4-tert-butyl-1,2-dihydro-3-benzothiepine has a molecular weight of 218.36 g/mol, XLogP of 4.36, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-1,2-dihydro-3-benzothiepine is sourced from PubChem (CID 15122704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).