C25H28FNO4 — CID 151227518
N-[(4-fluorophenyl)methyl]-4-hydroxy-3,10-dioxo-8-propan-2-yl-4,5,6,7,8,8a,9,10a-octahydroanthracene-2-carboxamide (PubChem CID 151227518) has the molecular formula C25H28FNO4 and a molecular weight of 425.50 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-4-hydroxy-3,10-dioxo-8-propan-2-yl-4,5,6,7,8,8a,9,10a-octahydroanthracene-2-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-4-hydroxy-3,10-dioxo-8-propan-2-yl-4,5,6,7,8,8a,9,10a-octahydroanthracene-2-carboxamide |
|---|---|
| PubChem CID | 151227518 |
| Molecular Formula | C25H28FNO4 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-4-hydroxy-3,10-dioxo-8-propan-2-yl-4,5,6,7,8,8a,9,10a-octahydroanthracene-2-carboxamide |
| SMILES | CC(C)C1CCCC2C(=O)C3=C(C=C(C(=O)NCc4ccc(F)cc4)C(=O)C3O)CC21 |
| InChI | InChI=1S/C25H28FNO4/c1-13(2)17-4-3-5-18-19(17)10-15-11-20(23(29)24(30)21(15)22(18)28)25(31)27-12-14-6-8-16(26)9-7-14/h6-9,11,13,17-19,24,30H,3-5,10,12H2,1-2H3,(H,27,31) |
| InChIKey | NNOSAYSUWKPXOC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|