C10H6F10 — CID 15122969
6,6,7,7,7-pentafluoro-2-methyl-3-(1,1,2,2,2-pentafluoroethyl)hept-2-en-4-yne (PubChem CID 15122969) has the molecular formula C10H6F10 and a molecular weight of 316.14 g/mol. Its IUPAC name is 6,6,7,7,7-pentafluoro-2-methyl-3-(1,1,2,2,2-pentafluoroethyl)hept-2-en-4-yne.
| Compound Name | 6,6,7,7,7-pentafluoro-2-methyl-3-(1,1,2,2,2-pentafluoroethyl)hept-2-en-4-yne |
|---|---|
| PubChem CID | 15122969 |
| Molecular Formula | C10H6F10 |
| Molecular Weight | 316.14 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 6,6,7,7,7-pentafluoro-2-methyl-3-(1,1,2,2,2-pentafluoroethyl)hept-2-en-4-yne |
| SMILES | CC(C)=C(C#CC(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H6F10/c1-5(2)6(8(13,14)10(18,19)20)3-4-7(11,12)9(15,16)17/h1-2H3 |
| InChIKey | RKUMFZIYMKVMDS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.14 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|