C12H8F10 — CID 15122975
1,1,1,5,5,6,6,7,7,7-decafluorohept-3-yn-2-ylidenecyclopentane (PubChem CID 15122975) has the molecular formula C12H8F10 and a molecular weight of 342.18 g/mol. Its IUPAC name is 1,1,1,5,5,6,6,7,7,7-decafluorohept-3-yn-2-ylidenecyclopentane.
| Compound Name | 1,1,1,5,5,6,6,7,7,7-decafluorohept-3-yn-2-ylidenecyclopentane |
|---|---|
| PubChem CID | 15122975 |
| Molecular Formula | C12H8F10 |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 1,1,1,5,5,6,6,7,7,7-decafluorohept-3-yn-2-ylidenecyclopentane |
| SMILES | FC(F)(F)C(C#CC(F)(F)C(F)(F)C(F)(F)F)=C1CCCC1 |
| InChI | InChI=1S/C12H8F10/c13-9(14,11(18,19)12(20,21)22)6-5-8(10(15,16)17)7-3-1-2-4-7/h1-4H2 |
| InChIKey | MMHLDEGBUZDZPA-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|