C10H9F7N2O2 — CID 151233911
ethyl 3-(1,1-difluoroethyl)-5-(1,1,2,2,2-pentafluoroethyl)-1H-pyrazole-4-carboxylate (PubChem CID 151233911) has the molecular formula C10H9F7N2O2 and a molecular weight of 322.18 g/mol. Its IUPAC name is ethyl 3-(1,1-difluoroethyl)-5-(1,1,2,2,2-pentafluoroethyl)-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 3-(1,1-difluoroethyl)-5-(1,1,2,2,2-pentafluoroethyl)-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 151233911 |
| Molecular Formula | C10H9F7N2O2 |
| Molecular Weight | 322.18 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | ethyl 3-(1,1-difluoroethyl)-5-(1,1,2,2,2-pentafluoroethyl)-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(C(C)(F)F)n[nH]c1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H9F7N2O2/c1-3-21-7(20)4-5(8(2,11)12)18-19-6(4)9(13,14)10(15,16)17/h3H2,1-2H3,(H,18,19) |
| InChIKey | NOWJDRLDVDXGBH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.18 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|