C12H18O6 — CID 15123486
1-(2-hydroxy-4,5,5,6-tetramethoxycyclohexa-1,3-dien-1-yl)ethanone (PubChem CID 15123486) has the molecular formula C12H18O6 and a molecular weight of 258.27 g/mol. Its IUPAC name is 1-(2-hydroxy-4,5,5,6-tetramethoxycyclohexa-1,3-dien-1-yl)ethanone.
| Compound Name | 1-(2-hydroxy-4,5,5,6-tetramethoxycyclohexa-1,3-dien-1-yl)ethanone |
|---|---|
| PubChem CID | 15123486 |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 1-(2-hydroxy-4,5,5,6-tetramethoxycyclohexa-1,3-dien-1-yl)ethanone |
| SMILES | COC1=CC(O)=C(C(C)=O)C(OC)C1(OC)OC |
| InChI | InChI=1S/C12H18O6/c1-7(13)10-8(14)6-9(15-2)12(17-4,18-5)11(10)16-3/h6,11,14H,1-5H3 |
| InChIKey | UPBNUIRGENFLOQ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|