C11H16O6 — CID 15123491
1-(2,6-dihydroxy-4,5,5-trimethoxycyclohexa-1,3-dien-1-yl)ethanone (PubChem CID 15123491) has the molecular formula C11H16O6 and a molecular weight of 244.24 g/mol. Its IUPAC name is 1-(2,6-dihydroxy-4,5,5-trimethoxycyclohexa-1,3-dien-1-yl)ethanone.
| Compound Name | 1-(2,6-dihydroxy-4,5,5-trimethoxycyclohexa-1,3-dien-1-yl)ethanone |
|---|---|
| PubChem CID | 15123491 |
| Molecular Formula | C11H16O6 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 1-(2,6-dihydroxy-4,5,5-trimethoxycyclohexa-1,3-dien-1-yl)ethanone |
| SMILES | COC1=CC(O)=C(C(C)=O)C(O)C1(OC)OC |
| InChI | InChI=1S/C11H16O6/c1-6(12)9-7(13)5-8(15-2)11(16-3,17-4)10(9)14/h5,10,13-14H,1-4H3 |
| InChIKey | HBSIHFYNFJMYNU-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|