C21H26N4O5S — CID 151235179
1-[3-(aminomethyl)phenyl]-4-methyl-3-(4-morpholin-4-ylphenyl)-5-oxoimidazolidine-2-sulfonic acid (PubChem CID 151235179) has the molecular formula C21H26N4O5S and a molecular weight of 446.53 g/mol. Its IUPAC name is 1-[3-(aminomethyl)phenyl]-4-methyl-3-(4-morpholin-4-ylphenyl)-5-oxoimidazolidine-2-sulfonic acid.
| Compound Name | 1-[3-(aminomethyl)phenyl]-4-methyl-3-(4-morpholin-4-ylphenyl)-5-oxoimidazolidine-2-sulfonic acid |
|---|---|
| PubChem CID | 151235179 |
| Molecular Formula | C21H26N4O5S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 1-[3-(aminomethyl)phenyl]-4-methyl-3-(4-morpholin-4-ylphenyl)-5-oxoimidazolidine-2-sulfonic acid |
| SMILES | CC1C(=O)N(c2cccc(CN)c2)C(S(=O)(=O)O)N1c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H26N4O5S/c1-15-20(26)25(19-4-2-3-16(13-19)14-22)21(31(27,28)29)24(15)18-7-5-17(6-8-18)23-9-11-30-12-10-23/h2-8,13,15,21H,9-12,14,22H2,1H3,(H,27,28,29) |
| InChIKey | NPCVWGXJHCIWJS-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 116.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|