C26H27N7O2 — CID 151235424
1-[6-[[4-[4-(piperidine-1-carbonyl)anilino]-1,3,5-triazin-2-yl]amino]-2,3-dihydroindol-1-yl]prop-2-en-1-one (PubChem CID 151235424) has the molecular formula C26H27N7O2 and a molecular weight of 469.55 g/mol. Its IUPAC name is 1-[6-[[4-[4-(piperidine-1-carbonyl)anilino]-1,3,5-triazin-2-yl]amino]-2,3-dihydroindol-1-yl]prop-2-en-1-one.
| Compound Name | 1-[6-[[4-[4-(piperidine-1-carbonyl)anilino]-1,3,5-triazin-2-yl]amino]-2,3-dihydroindol-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 151235424 |
| Molecular Formula | C26H27N7O2 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | 1-[6-[[4-[4-(piperidine-1-carbonyl)anilino]-1,3,5-triazin-2-yl]amino]-2,3-dihydroindol-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCc2ccc(Nc3ncnc(Nc4ccc(C(=O)N5CCCCC5)cc4)n3)cc21 |
| InChI | InChI=1S/C26H27N7O2/c1-2-23(34)33-15-12-18-6-11-21(16-22(18)33)30-26-28-17-27-25(31-26)29-20-9-7-19(8-10-20)24(35)32-13-4-3-5-14-32/h2,6-11,16-17H,1,3-5,12-15H2,(H2,27,28,29,30,31) |
| InChIKey | NPDZQULEJWBSLS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|