C6H3F9O2 — CID 15123682
2,2,4-tris(trifluoromethyl)-1,3-dioxolane (PubChem CID 15123682) has the molecular formula C6H3F9O2 and a molecular weight of 278.07 g/mol. Its IUPAC name is 2,2,4-tris(trifluoromethyl)-1,3-dioxolane.
| Compound Name | 2,2,4-tris(trifluoromethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 15123682 |
| Molecular Formula | C6H3F9O2 |
| Molecular Weight | 278.07 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | 2,2,4-tris(trifluoromethyl)-1,3-dioxolane |
| SMILES | FC(F)(F)C1COC(C(F)(F)F)(C(F)(F)F)O1 |
| InChI | InChI=1S/C6H3F9O2/c7-3(8,9)2-1-16-4(17-2,5(10,11)12)6(13,14)15/h2H,1H2 |
| InChIKey | BSMSMGSVKSFCMV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.07 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |