About (5-methyl-4,5-dipropyloctan-4-yl)hydrazine
(5-methyl-4,5-dipropyloctan-4-yl)hydrazine (PubChem CID 151240436) has the molecular formula C15H34N2
and a molecular weight of 242.45 g/mol. Its IUPAC name is (5-methyl-4,5-dipropyloctan-4-yl)hydrazine.
Molecular Properties
| Compound Name | (5-methyl-4,5-dipropyloctan-4-yl)hydrazine |
| PubChem CID | 151240436 |
| Molecular Formula | C15H34N2 |
| Molecular Weight | 242.45 g/mol |
| Exact Mass | 242.27 |
| IUPAC Name | (5-methyl-4,5-dipropyloctan-4-yl)hydrazine |
| SMILES | CCCC(C)(CCC)C(CCC)(CCC)NN |
| InChI | InChI=1S/C15H34N2/c1-6-10-14(5,11-7-2)15(17-16,12-8-3)13-9-4/h17H,6-13,16H2,1-5H3 |
| InChIKey | NQEOLSLLQWLCSL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5-methyl-4,5-dipropyloctan-4-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-4,5-dipropyloctan-4-yl)hydrazine?
The IUPAC name of (5-methyl-4,5-dipropyloctan-4-yl)hydrazine (CID 151240436) is (5-methyl-4,5-dipropyloctan-4-yl)hydrazine.
What is the SMILES notation for (5-methyl-4,5-dipropyloctan-4-yl)hydrazine?
The canonical SMILES for (5-methyl-4,5-dipropyloctan-4-yl)hydrazine is CCCC(C)(CCC)C(CCC)(CCC)NN.
What is the InChIKey of (5-methyl-4,5-dipropyloctan-4-yl)hydrazine?
The InChIKey is NQEOLSLLQWLCSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H34N2/c1-6-10-14(5,11-7-2)15(17-16,12-8-3)13-9-4/h17H,6-13,16H2,1-5H3.
What are the key properties of (5-methyl-4,5-dipropyloctan-4-yl)hydrazine?
(5-methyl-4,5-dipropyloctan-4-yl)hydrazine has a molecular weight of 242.45 g/mol, XLogP of 4.40, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-4,5-dipropyloctan-4-yl)hydrazine is sourced from PubChem (CID 151240436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).