C16H10ClF2NO3S — CID 151240969
(5-chlorothieno[2,3-c]pyridin-2-yl)-(2,6-difluoro-3,5-dimethoxyphenyl)methanone (PubChem CID 151240969) has the molecular formula C16H10ClF2NO3S and a molecular weight of 369.78 g/mol. Its IUPAC name is (5-chlorothieno[2,3-c]pyridin-2-yl)-(2,6-difluoro-3,5-dimethoxyphenyl)methanone.
| Compound Name | (5-chlorothieno[2,3-c]pyridin-2-yl)-(2,6-difluoro-3,5-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 151240969 |
| Molecular Formula | C16H10ClF2NO3S |
| Molecular Weight | 369.78 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | (5-chlorothieno[2,3-c]pyridin-2-yl)-(2,6-difluoro-3,5-dimethoxyphenyl)methanone |
| SMILES | COc1cc(OC)c(F)c(C(=O)c2cc3cc(Cl)ncc3s2)c1F |
| InChI | InChI=1S/C16H10ClF2NO3S/c1-22-8-5-9(23-2)15(19)13(14(8)18)16(21)10-3-7-4-12(17)20-6-11(7)24-10/h3-6H,1-2H3 |
| InChIKey | NQHNGRHBRCLDJG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.78 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|