About 2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethylsulfanyl acetate
2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethylsulfanyl acetate (PubChem CID 151243454) has the molecular formula C9H12N2O4S
and a molecular weight of 244.27 g/mol. Its IUPAC name is 2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethylsulfanyl acetate.
Molecular Properties
| Compound Name | 2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethylsulfanyl acetate |
| PubChem CID | 151243454 |
| Molecular Formula | C9H12N2O4S |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethylsulfanyl acetate |
| SMILES | CC(=O)OSCCn1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H12N2O4S/c1-6-5-11(9(14)10-8(6)13)3-4-16-15-7(2)12/h5H,3-4H2,1-2H3,(H,10,13,14) |
| InChIKey | NQUKSLZIBNDSLQ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethylsulfanyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethylsulfanyl acetate?
The IUPAC name of 2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethylsulfanyl acetate (CID 151243454) is 2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethylsulfanyl acetate.
What is the SMILES notation for 2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethylsulfanyl acetate?
The canonical SMILES for 2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethylsulfanyl acetate is CC(=O)OSCCn1cc(C)c(=O)[nH]c1=O.
What is the InChIKey of 2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethylsulfanyl acetate?
The InChIKey is NQUKSLZIBNDSLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O4S/c1-6-5-11(9(14)10-8(6)13)3-4-16-15-7(2)12/h5H,3-4H2,1-2H3,(H,10,13,14).
What are the key properties of 2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethylsulfanyl acetate?
2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethylsulfanyl acetate has a molecular weight of 244.27 g/mol, XLogP of 0.06, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethylsulfanyl acetate is sourced from PubChem (CID 151243454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).