C20H29FN4O5 — CID 151244068
4-O-tert-butyl 11-O-ethyl (5R)-11-fluoro-5,13-dimethyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4,11-dicarboxylate (PubChem CID 151244068) has the molecular formula C20H29FN4O5 and a molecular weight of 424.47 g/mol. Its IUPAC name is 4-O-tert-butyl 11-O-ethyl (5R)-11-fluoro-5,13-dimethyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4,11-dicarboxylate.
| Compound Name | 4-O-tert-butyl 11-O-ethyl (5R)-11-fluoro-5,13-dimethyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4,11-dicarboxylate |
|---|---|
| PubChem CID | 151244068 |
| Molecular Formula | C20H29FN4O5 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 4-O-tert-butyl 11-O-ethyl (5R)-11-fluoro-5,13-dimethyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4,11-dicarboxylate |
| SMILES | CCOC(=O)C1(F)CN(C)C(=O)c2c3c(nn2C1)C[C@@H](C)N(C(=O)OC(C)(C)C)C3 |
| InChI | InChI=1S/C20H29FN4O5/c1-7-29-17(27)20(21)10-23(6)16(26)15-13-9-24(18(28)30-19(3,4)5)12(2)8-14(13)22-25(15)11-20/h12H,7-11H2,1-6H3/t12-,20?/m1/s1 |
| InChIKey | NQXRDBFDGGTFPO-ZRIYNBNISA-N |
| XLogP | 1.92 |
| TPSA | 93.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |