C18H9F11O2 — CID 151245335
2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-1-(4-phenylphenyl)propan-1-one (PubChem CID 151245335) has the molecular formula C18H9F11O2 and a molecular weight of 466.25 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-1-(4-phenylphenyl)propan-1-one.
| Compound Name | 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-1-(4-phenylphenyl)propan-1-one |
|---|---|
| PubChem CID | 151245335 |
| Molecular Formula | C18H9F11O2 |
| Molecular Weight | 466.25 g/mol |
| Exact Mass | 466.04 |
| IUPAC Name | 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-1-(4-phenylphenyl)propan-1-one |
| SMILES | O=C(c1ccc(-c2ccccc2)cc1)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H9F11O2/c19-14(16(22,23)24,31-18(28,29)15(20,21)17(25,26)27)13(30)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H |
| InChIKey | NREJTBXLCRFURW-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.25 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|