C32H35ClF3N3O3 — CID 151245684
propan-2-yl 6-chloro-2-oxo-1-[[1-(4,4,4-trifluorobutyl)-4,5,6,7-tetrahydrobenzimidazol-2-yl]methyl]spiro[1,4-dihydroanthracene-3,3'-azetidine]-1'-carboxylate (PubChem CID 151245684) has the molecular formula C32H35ClF3N3O3 and a molecular weight of 602.10 g/mol. Its IUPAC name is propan-2-yl 6-chloro-2-oxo-1-[[1-(4,4,4-trifluorobutyl)-4,5,6,7-tetrahydrobenzimidazol-2-yl]methyl]spiro[1,4-dihydroanthracene-3,3'-azetidine]-1'-carboxylate.
| Compound Name | propan-2-yl 6-chloro-2-oxo-1-[[1-(4,4,4-trifluorobutyl)-4,5,6,7-tetrahydrobenzimidazol-2-yl]methyl]spiro[1,4-dihydroanthracene-3,3'-azetidine]-1'-carboxylate |
|---|---|
| PubChem CID | 151245684 |
| Molecular Formula | C32H35ClF3N3O3 |
| Molecular Weight | 602.10 g/mol |
| Exact Mass | 601.23 |
| IUPAC Name | propan-2-yl 6-chloro-2-oxo-1-[[1-(4,4,4-trifluorobutyl)-4,5,6,7-tetrahydrobenzimidazol-2-yl]methyl]spiro[1,4-dihydroanthracene-3,3'-azetidine]-1'-carboxylate |
| SMILES | CC(C)OC(=O)N1CC2(Cc3cc4cc(Cl)ccc4cc3C(Cc3nc4c(n3CCCC(F)(F)F)CCCC4)C2=O)C1 |
| InChI | InChI=1S/C32H35ClF3N3O3/c1-19(2)42-30(41)38-17-31(18-38)16-22-12-21-13-23(33)9-8-20(21)14-24(22)25(29(31)40)15-28-37-26-6-3-4-7-27(26)39(28)11-5-10-32(34,35)36/h8-9,12-14,19,25H,3-7,10-11,15-18H2,1-2H3 |
| InChIKey | NRGHDUWNKOMCRR-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.10 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |