About (1-benzylpiperidin-4-yl) benzoate
(1-benzylpiperidin-4-yl) benzoate (PubChem CID 15124790) has the molecular formula C19H21NO2
and a molecular weight of 295.38 g/mol. Its IUPAC name is (1-benzylpiperidin-4-yl) benzoate.
Molecular Properties
| Compound Name | (1-benzylpiperidin-4-yl) benzoate |
| PubChem CID | 15124790 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | (1-benzylpiperidin-4-yl) benzoate |
| SMILES | O=C(OC1CCN(Cc2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C19H21NO2/c21-19(17-9-5-2-6-10-17)22-18-11-13-20(14-12-18)15-16-7-3-1-4-8-16/h1-10,18H,11-15H2 |
| InChIKey | SBQQIGHODWKFKK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-benzylpiperidin-4-yl) benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-benzylpiperidin-4-yl) benzoate?
The IUPAC name of (1-benzylpiperidin-4-yl) benzoate (CID 15124790) is (1-benzylpiperidin-4-yl) benzoate.
What is the SMILES notation for (1-benzylpiperidin-4-yl) benzoate?
The canonical SMILES for (1-benzylpiperidin-4-yl) benzoate is O=C(OC1CCN(Cc2ccccc2)CC1)c1ccccc1.
What is the InChIKey of (1-benzylpiperidin-4-yl) benzoate?
The InChIKey is SBQQIGHODWKFKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO2/c21-19(17-9-5-2-6-10-17)22-18-11-13-20(14-12-18)15-16-7-3-1-4-8-16/h1-10,18H,11-15H2.
What are the key properties of (1-benzylpiperidin-4-yl) benzoate?
(1-benzylpiperidin-4-yl) benzoate has a molecular weight of 295.38 g/mol, XLogP of 3.51, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-benzylpiperidin-4-yl) benzoate is sourced from PubChem (CID 15124790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).