C11H11ClF3NO — CID 15124812
3-[4-chloro-3-(trifluoromethyl)phenyl]pyrrolidin-3-ol (PubChem CID 15124812) has the molecular formula C11H11ClF3NO and a molecular weight of 265.66 g/mol. Its IUPAC name is 3-[4-chloro-3-(trifluoromethyl)phenyl]pyrrolidin-3-ol.
| Compound Name | 3-[4-chloro-3-(trifluoromethyl)phenyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 15124812 |
| Molecular Formula | C11H11ClF3NO |
| Molecular Weight | 265.66 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 3-[4-chloro-3-(trifluoromethyl)phenyl]pyrrolidin-3-ol |
| SMILES | OC1(c2ccc(Cl)c(C(F)(F)F)c2)CCNC1 |
| InChI | InChI=1S/C11H11ClF3NO/c12-9-2-1-7(5-8(9)11(13,14)15)10(17)3-4-16-6-10/h1-2,5,16-17H,3-4,6H2 |
| InChIKey | ZUZCHCBAMFLMJO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.66 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |