C10H7F13O — CID 15124829
1,1,1,4,5,5,5-heptafluoro-3-propoxy-2,4-bis(trifluoromethyl)pent-2-ene (PubChem CID 15124829) has the molecular formula C10H7F13O and a molecular weight of 390.14 g/mol. Its IUPAC name is 1,1,1,4,5,5,5-heptafluoro-3-propoxy-2,4-bis(trifluoromethyl)pent-2-ene.
| Compound Name | 1,1,1,4,5,5,5-heptafluoro-3-propoxy-2,4-bis(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 15124829 |
| Molecular Formula | C10H7F13O |
| Molecular Weight | 390.14 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | 1,1,1,4,5,5,5-heptafluoro-3-propoxy-2,4-bis(trifluoromethyl)pent-2-ene |
| SMILES | CCCOC(=C(C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H7F13O/c1-2-3-24-5(4(7(12,13)14)8(15,16)17)6(11,9(18,19)20)10(21,22)23/h2-3H2,1H3 |
| InChIKey | PFKDVNAEYIIJQJ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.14 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|