C9H8F13N — CID 15124834
N-ethyl-1,1,1,3,3,4,4,5,5,5-decafluoro-N-methyl-2-(trifluoromethyl)pentan-2-amine (PubChem CID 15124834) has the molecular formula C9H8F13N and a molecular weight of 377.14 g/mol. Its IUPAC name is N-ethyl-1,1,1,3,3,4,4,5,5,5-decafluoro-N-methyl-2-(trifluoromethyl)pentan-2-amine.
| Compound Name | N-ethyl-1,1,1,3,3,4,4,5,5,5-decafluoro-N-methyl-2-(trifluoromethyl)pentan-2-amine |
|---|---|
| PubChem CID | 15124834 |
| Molecular Formula | C9H8F13N |
| Molecular Weight | 377.14 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | N-ethyl-1,1,1,3,3,4,4,5,5,5-decafluoro-N-methyl-2-(trifluoromethyl)pentan-2-amine |
| SMILES | CCN(C)C(C(F)(F)F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H8F13N/c1-3-23(2)4(7(14,15)16,8(17,18)19)5(10,11)6(12,13)9(20,21)22/h3H2,1-2H3 |
| InChIKey | CMUMPVZAKIMLEQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.14 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|