C11F24O — CID 15124852
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluoro-7-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yloxy)heptane (PubChem CID 15124852) has the molecular formula C11F24O and a molecular weight of 604.07 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluoro-7-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yloxy)heptane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluoro-7-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yloxy)heptane |
|---|---|
| PubChem CID | 15124852 |
| Molecular Formula | C11F24O |
| Molecular Weight | 604.07 g/mol |
| Exact Mass | 603.96 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluoro-7-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yloxy)heptane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11F24O/c12-1(13,2(14,15)4(18,19)8(25,26)27)3(16,17)5(20,21)11(34,35)36-7(24,10(31,32)33)6(22,23)9(28,29)30 |
| InChIKey | JCQOLKCYSYTWBI-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.07 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|