C23H29FO3 — CID 15125102
7-(4-fluorophenyl)-7-(2-hydroxy-3,4,5,6-tetramethylphenyl)heptanoic acid (PubChem CID 15125102) has the molecular formula C23H29FO3 and a molecular weight of 372.48 g/mol. Its IUPAC name is 7-(4-fluorophenyl)-7-(2-hydroxy-3,4,5,6-tetramethylphenyl)heptanoic acid.
| Compound Name | 7-(4-fluorophenyl)-7-(2-hydroxy-3,4,5,6-tetramethylphenyl)heptanoic acid |
|---|---|
| PubChem CID | 15125102 |
| Molecular Formula | C23H29FO3 |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 7-(4-fluorophenyl)-7-(2-hydroxy-3,4,5,6-tetramethylphenyl)heptanoic acid |
| SMILES | Cc1c(C)c(C)c(C(CCCCCC(=O)O)c2ccc(F)cc2)c(O)c1C |
| InChI | InChI=1S/C23H29FO3/c1-14-15(2)17(4)23(27)22(16(14)3)20(8-6-5-7-9-21(25)26)18-10-12-19(24)13-11-18/h10-13,20,27H,5-9H2,1-4H3,(H,25,26) |
| InChIKey | NHHQNGUCEHAEJW-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|