C13H15F2NO — CID 151254887
4-[2-(3,4-difluorophenyl)butyl]-4,5-dihydro-1,3-oxazole (PubChem CID 151254887) has the molecular formula C13H15F2NO and a molecular weight of 239.26 g/mol. Its IUPAC name is 4-[2-(3,4-difluorophenyl)butyl]-4,5-dihydro-1,3-oxazole.
| Compound Name | 4-[2-(3,4-difluorophenyl)butyl]-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 151254887 |
| Molecular Formula | C13H15F2NO |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 4-[2-(3,4-difluorophenyl)butyl]-4,5-dihydro-1,3-oxazole |
| SMILES | CCC(CC1COC=N1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H15F2NO/c1-2-9(5-11-7-17-8-16-11)10-3-4-12(14)13(15)6-10/h3-4,6,8-9,11H,2,5,7H2,1H3 |
| InChIKey | NTCUNIVCEVZBMT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |