C12H11F2N2S2+ — CID 15125706
6,7-difluoro-5-methyl-1-methylsulfanyl-4H-[1,3]thiazolo[3,4-a]quinoxalin-10-ium (PubChem CID 15125706) has the molecular formula C12H11F2N2S2+ and a molecular weight of 285.36 g/mol. Its IUPAC name is 6,7-difluoro-5-methyl-1-methylsulfanyl-4H-[1,3]thiazolo[3,4-a]quinoxalin-10-ium.
| Compound Name | 6,7-difluoro-5-methyl-1-methylsulfanyl-4H-[1,3]thiazolo[3,4-a]quinoxalin-10-ium |
|---|---|
| PubChem CID | 15125706 |
| Molecular Formula | C12H11F2N2S2+ |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | 6,7-difluoro-5-methyl-1-methylsulfanyl-4H-[1,3]thiazolo[3,4-a]quinoxalin-10-ium |
| SMILES | CSc1scc2[n+]1-c1ccc(F)c(F)c1N(C)C2 |
| InChI | InChI=1S/C12H11F2N2S2/c1-15-5-7-6-18-12(17-2)16(7)9-4-3-8(13)10(14)11(9)15/h3-4,6H,5H2,1-2H3/q+1 |
| InChIKey | ZAOFYFSNYIOOBB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|