C18H17FN2O3 — CID 151258069
7-[(4-fluorophenyl)methoxy]-2-(2-methoxyethyl)-3H-quinazolin-4-one (PubChem CID 151258069) has the molecular formula C18H17FN2O3 and a molecular weight of 328.34 g/mol. Its IUPAC name is 7-[(4-fluorophenyl)methoxy]-2-(2-methoxyethyl)-3H-quinazolin-4-one.
| Compound Name | 7-[(4-fluorophenyl)methoxy]-2-(2-methoxyethyl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 151258069 |
| Molecular Formula | C18H17FN2O3 |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 7-[(4-fluorophenyl)methoxy]-2-(2-methoxyethyl)-3H-quinazolin-4-one |
| SMILES | COCCc1nc2cc(OCc3ccc(F)cc3)ccc2c(=O)[nH]1 |
| InChI | InChI=1S/C18H17FN2O3/c1-23-9-8-17-20-16-10-14(6-7-15(16)18(22)21-17)24-11-12-2-4-13(19)5-3-12/h2-7,10H,8-9,11H2,1H3,(H,20,21,22) |
| InChIKey | NTTOFLPRFNAFDO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |