About spiro[1,3-dioxole-2,3'-indole]-5'-amine
spiro[1,3-dioxole-2,3'-indole]-5'-amine (PubChem CID 151258718) has the molecular formula C10H8N2O2
and a molecular weight of 188.19 g/mol. Its IUPAC name is spiro[1,3-dioxole-2,3'-indole]-5'-amine.
Molecular Properties
| Compound Name | spiro[1,3-dioxole-2,3'-indole]-5'-amine |
| PubChem CID | 151258718 |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | spiro[1,3-dioxole-2,3'-indole]-5'-amine |
| SMILES | Nc1ccc2c(c1)C1(C=N2)OC=CO1 |
| InChI | InChI=1S/C10H8N2O2/c11-7-1-2-9-8(5-7)10(6-12-9)13-3-4-14-10/h1-6H,11H2 |
| InChIKey | NTXDYPXWFHTWKH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze spiro[1,3-dioxole-2,3'-indole]-5'-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,3-dioxole-2,3'-indole]-5'-amine?
The IUPAC name of spiro[1,3-dioxole-2,3'-indole]-5'-amine (CID 151258718) is spiro[1,3-dioxole-2,3'-indole]-5'-amine.
What is the SMILES notation for spiro[1,3-dioxole-2,3'-indole]-5'-amine?
The canonical SMILES for spiro[1,3-dioxole-2,3'-indole]-5'-amine is Nc1ccc2c(c1)C1(C=N2)OC=CO1.
What is the InChIKey of spiro[1,3-dioxole-2,3'-indole]-5'-amine?
The InChIKey is NTXDYPXWFHTWKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O2/c11-7-1-2-9-8(5-7)10(6-12-9)13-3-4-14-10/h1-6H,11H2.
What are the key properties of spiro[1,3-dioxole-2,3'-indole]-5'-amine?
spiro[1,3-dioxole-2,3'-indole]-5'-amine has a molecular weight of 188.19 g/mol, XLogP of 1.66, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,3-dioxole-2,3'-indole]-5'-amine is sourced from PubChem (CID 151258718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).