C21H30O2 — CID 15125877
(4E,6E,8E)-2,7-dimethyl-3-methylidene-9-(2,6,6-trimethylcyclohexen-1-yl)nona-4,6,8-trienoic acid (PubChem CID 15125877) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is (4E,6E,8E)-2,7-dimethyl-3-methylidene-9-(2,6,6-trimethylcyclohexen-1-yl)nona-4,6,8-trienoic acid.
| Compound Name | (4E,6E,8E)-2,7-dimethyl-3-methylidene-9-(2,6,6-trimethylcyclohexen-1-yl)nona-4,6,8-trienoic acid |
|---|---|
| PubChem CID | 15125877 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | (4E,6E,8E)-2,7-dimethyl-3-methylidene-9-(2,6,6-trimethylcyclohexen-1-yl)nona-4,6,8-trienoic acid |
| SMILES | C=C(/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C)C(C)C(=O)O |
| InChI | InChI=1S/C21H30O2/c1-15(9-7-10-16(2)18(4)20(22)23)12-13-19-17(3)11-8-14-21(19,5)6/h7,9-10,12-13,18H,2,8,11,14H2,1,3-6H3,(H,22,23)/b10-7+,13-12+,15-9+ |
| InChIKey | JVNZTBXNNSQXJS-FGKSVAIXSA-N |
| XLogP | 5.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|