1-methyl-2,5-dihydropyrrole-3-carboxylic acid

C6H9NO2 — CID 15125940

IUPAC1-methyl-2,5-dihydropyrrole-3-carboxylic acid
SMILESCN1CC=C(C(=O)O)C1
InChIInChI=1S/C6H9NO2/c1-7-3-2-5(4-7)6(8)9/h2H,3-4H2,1H3,(H,8,9)
InChIKeyJTCLUVOKSLROST-UHFFFAOYSA-N
MW127.14 g/mol
LogP-0.06
Rot. Bonds1

About 1-methyl-2,5-dihydropyrrole-3-carboxylic acid

1-methyl-2,5-dihydropyrrole-3-carboxylic acid (PubChem CID 15125940) has the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. Its IUPAC name is 1-methyl-2,5-dihydropyrrole-3-carboxylic acid.

Molecular Properties

Compound Name1-methyl-2,5-dihydropyrrole-3-carboxylic acid
PubChem CID15125940
Molecular FormulaC6H9NO2
Molecular Weight127.14 g/mol
Exact Mass127.06
IUPAC Name1-methyl-2,5-dihydropyrrole-3-carboxylic acid
SMILESCN1CC=C(C(=O)O)C1
InChIInChI=1S/C6H9NO2/c1-7-3-2-5(4-7)6(8)9/h2H,3-4H2,1H3,(H,8,9)
InChIKeyJTCLUVOKSLROST-UHFFFAOYSA-N
XLogP-0.06
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500127.14
LogP ≤ 5-0.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 1-methyl-2,5-dihydropyrrole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-methyl-2,5-dihydropyrrole-3-carboxylic acid?
The IUPAC name of 1-methyl-2,5-dihydropyrrole-3-carboxylic acid (CID 15125940) is 1-methyl-2,5-dihydropyrrole-3-carboxylic acid.
What is the SMILES notation for 1-methyl-2,5-dihydropyrrole-3-carboxylic acid?
The canonical SMILES for 1-methyl-2,5-dihydropyrrole-3-carboxylic acid is CN1CC=C(C(=O)O)C1.
What is the InChIKey of 1-methyl-2,5-dihydropyrrole-3-carboxylic acid?
The InChIKey is JTCLUVOKSLROST-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2/c1-7-3-2-5(4-7)6(8)9/h2H,3-4H2,1H3,(H,8,9).
What are the key properties of 1-methyl-2,5-dihydropyrrole-3-carboxylic acid?
1-methyl-2,5-dihydropyrrole-3-carboxylic acid has a molecular weight of 127.14 g/mol, XLogP of -0.06, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2,5-dihydropyrrole-3-carboxylic acid is sourced from PubChem (CID 15125940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).