C6H9NO2 — CID 15125940
1-methyl-2,5-dihydropyrrole-3-carboxylic acid (PubChem CID 15125940) has the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. Its IUPAC name is 1-methyl-2,5-dihydropyrrole-3-carboxylic acid.
| Compound Name | 1-methyl-2,5-dihydropyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 15125940 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | 1-methyl-2,5-dihydropyrrole-3-carboxylic acid |
| SMILES | CN1CC=C(C(=O)O)C1 |
| InChI | InChI=1S/C6H9NO2/c1-7-3-2-5(4-7)6(8)9/h2H,3-4H2,1H3,(H,8,9) |
| InChIKey | JTCLUVOKSLROST-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |