2-methyl-2,5-dihydro-1H-pyrrole-3-carboxylic acid

C6H9NO2 — CID 15125944

IUPAC2-methyl-2,5-dihydro-1H-pyrrole-3-carboxylic acid
SMILESCC1NCC=C1C(=O)O
InChIInChI=1S/C6H9NO2/c1-4-5(6(8)9)2-3-7-4/h2,4,7H,3H2,1H3,(H,8,9)
InChIKeyPLTJKKPKPQJSGB-UHFFFAOYSA-N
MW127.14 g/mol
LogP-0.01
Rot. Bonds1

About 2-methyl-2,5-dihydro-1H-pyrrole-3-carboxylic acid

2-methyl-2,5-dihydro-1H-pyrrole-3-carboxylic acid (PubChem CID 15125944) has the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. Its IUPAC name is 2-methyl-2,5-dihydro-1H-pyrrole-3-carboxylic acid.

Molecular Properties

Compound Name2-methyl-2,5-dihydro-1H-pyrrole-3-carboxylic acid
PubChem CID15125944
Molecular FormulaC6H9NO2
Molecular Weight127.14 g/mol
Exact Mass127.06
IUPAC Name2-methyl-2,5-dihydro-1H-pyrrole-3-carboxylic acid
SMILESCC1NCC=C1C(=O)O
InChIInChI=1S/C6H9NO2/c1-4-5(6(8)9)2-3-7-4/h2,4,7H,3H2,1H3,(H,8,9)
InChIKeyPLTJKKPKPQJSGB-UHFFFAOYSA-N
XLogP-0.01
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500127.14
LogP ≤ 5-0.01
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-methyl-2,5-dihydro-1H-pyrrole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-2,5-dihydro-1H-pyrrole-3-carboxylic acid?
The IUPAC name of 2-methyl-2,5-dihydro-1H-pyrrole-3-carboxylic acid (CID 15125944) is 2-methyl-2,5-dihydro-1H-pyrrole-3-carboxylic acid.
What is the SMILES notation for 2-methyl-2,5-dihydro-1H-pyrrole-3-carboxylic acid?
The canonical SMILES for 2-methyl-2,5-dihydro-1H-pyrrole-3-carboxylic acid is CC1NCC=C1C(=O)O.
What is the InChIKey of 2-methyl-2,5-dihydro-1H-pyrrole-3-carboxylic acid?
The InChIKey is PLTJKKPKPQJSGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2/c1-4-5(6(8)9)2-3-7-4/h2,4,7H,3H2,1H3,(H,8,9).
What are the key properties of 2-methyl-2,5-dihydro-1H-pyrrole-3-carboxylic acid?
2-methyl-2,5-dihydro-1H-pyrrole-3-carboxylic acid has a molecular weight of 127.14 g/mol, XLogP of -0.01, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2,5-dihydro-1H-pyrrole-3-carboxylic acid is sourced from PubChem (CID 15125944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).