About 2-methyl-2,5-dihydro-1H-pyrrole-3-carboxylic acid
2-methyl-2,5-dihydro-1H-pyrrole-3-carboxylic acid (PubChem CID 15125944) has the molecular formula C6H9NO2
and a molecular weight of 127.14 g/mol. Its IUPAC name is 2-methyl-2,5-dihydro-1H-pyrrole-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-methyl-2,5-dihydro-1H-pyrrole-3-carboxylic acid |
| PubChem CID | 15125944 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | 2-methyl-2,5-dihydro-1H-pyrrole-3-carboxylic acid |
| SMILES | CC1NCC=C1C(=O)O |
| InChI | InChI=1S/C6H9NO2/c1-4-5(6(8)9)2-3-7-4/h2,4,7H,3H2,1H3,(H,8,9) |
| InChIKey | PLTJKKPKPQJSGB-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-2,5-dihydro-1H-pyrrole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2,5-dihydro-1H-pyrrole-3-carboxylic acid?
The IUPAC name of 2-methyl-2,5-dihydro-1H-pyrrole-3-carboxylic acid (CID 15125944) is 2-methyl-2,5-dihydro-1H-pyrrole-3-carboxylic acid.
What is the SMILES notation for 2-methyl-2,5-dihydro-1H-pyrrole-3-carboxylic acid?
The canonical SMILES for 2-methyl-2,5-dihydro-1H-pyrrole-3-carboxylic acid is CC1NCC=C1C(=O)O.
What is the InChIKey of 2-methyl-2,5-dihydro-1H-pyrrole-3-carboxylic acid?
The InChIKey is PLTJKKPKPQJSGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2/c1-4-5(6(8)9)2-3-7-4/h2,4,7H,3H2,1H3,(H,8,9).
What are the key properties of 2-methyl-2,5-dihydro-1H-pyrrole-3-carboxylic acid?
2-methyl-2,5-dihydro-1H-pyrrole-3-carboxylic acid has a molecular weight of 127.14 g/mol, XLogP of -0.01, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2,5-dihydro-1H-pyrrole-3-carboxylic acid is sourced from PubChem (CID 15125944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).