C22H38N2 — CID 151260872
N-decan-2-yl-N-(piperidin-2-ylmethyl)aniline (PubChem CID 151260872) has the molecular formula C22H38N2 and a molecular weight of 330.56 g/mol. Its IUPAC name is N-decan-2-yl-N-(piperidin-2-ylmethyl)aniline.
| Compound Name | N-decan-2-yl-N-(piperidin-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 151260872 |
| Molecular Formula | C22H38N2 |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.30 |
| IUPAC Name | N-decan-2-yl-N-(piperidin-2-ylmethyl)aniline |
| SMILES | CCCCCCCCC(C)N(CC1CCCCN1)c1ccccc1 |
| InChI | InChI=1S/C22H38N2/c1-3-4-5-6-7-9-14-20(2)24(22-16-10-8-11-17-22)19-21-15-12-13-18-23-21/h8,10-11,16-17,20-21,23H,3-7,9,12-15,18-19H2,1-2H3 |
| InChIKey | NUHVPCBEEQFCHH-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|