C26H29NO2 — CID 151263569
3-(5,5-dibenzylcyclooctyl)pyrrole-2,5-dione (PubChem CID 151263569) has the molecular formula C26H29NO2 and a molecular weight of 387.52 g/mol. Its IUPAC name is 3-(5,5-dibenzylcyclooctyl)pyrrole-2,5-dione.
| Compound Name | 3-(5,5-dibenzylcyclooctyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 151263569 |
| Molecular Formula | C26H29NO2 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 3-(5,5-dibenzylcyclooctyl)pyrrole-2,5-dione |
| SMILES | O=C1C=C(C2CCCC(Cc3ccccc3)(Cc3ccccc3)CCC2)C(=O)N1 |
| InChI | InChI=1S/C26H29NO2/c28-24-17-23(25(29)27-24)22-13-7-15-26(16-8-14-22,18-20-9-3-1-4-10-20)19-21-11-5-2-6-12-21/h1-6,9-12,17,22H,7-8,13-16,18-19H2,(H,27,28,29) |
| InChIKey | NUVXBGCGNKQRRT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|