C12H12NO2S+ — CID 151263787
1-(3-methoxyphenyl)-2-(1,3-thiazol-3-ium-2-yl)ethanone (PubChem CID 151263787) has the molecular formula C12H12NO2S+ and a molecular weight of 234.30 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-2-(1,3-thiazol-3-ium-2-yl)ethanone.
| Compound Name | 1-(3-methoxyphenyl)-2-(1,3-thiazol-3-ium-2-yl)ethanone |
|---|---|
| PubChem CID | 151263787 |
| Molecular Formula | C12H12NO2S+ |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 1-(3-methoxyphenyl)-2-(1,3-thiazol-3-ium-2-yl)ethanone |
| SMILES | COc1cccc(C(=O)Cc2[nH+]ccs2)c1 |
| InChI | InChI=1S/C12H11NO2S/c1-15-10-4-2-3-9(7-10)11(14)8-12-13-5-6-16-12/h2-7H,8H2,1H3/p+1 |
| InChIKey | NUXARTVCVXWUCV-UHFFFAOYSA-O |
| XLogP | 2.00 |
| TPSA | 40.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |