C22H29N5O3 — CID 151264214
ethyl 4-[[2-amino-4-(pentylamino)pyrrolo[3,2-d]pyrimidin-5-yl]methyl]-3-methoxybenzoate (PubChem CID 151264214) has the molecular formula C22H29N5O3 and a molecular weight of 411.51 g/mol. Its IUPAC name is ethyl 4-[[2-amino-4-(pentylamino)pyrrolo[3,2-d]pyrimidin-5-yl]methyl]-3-methoxybenzoate.
| Compound Name | ethyl 4-[[2-amino-4-(pentylamino)pyrrolo[3,2-d]pyrimidin-5-yl]methyl]-3-methoxybenzoate |
|---|---|
| PubChem CID | 151264214 |
| Molecular Formula | C22H29N5O3 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | ethyl 4-[[2-amino-4-(pentylamino)pyrrolo[3,2-d]pyrimidin-5-yl]methyl]-3-methoxybenzoate |
| SMILES | CCCCCNc1nc(N)nc2ccn(Cc3ccc(C(=O)OCC)cc3OC)c12 |
| InChI | InChI=1S/C22H29N5O3/c1-4-6-7-11-24-20-19-17(25-22(23)26-20)10-12-27(19)14-16-9-8-15(13-18(16)29-3)21(28)30-5-2/h8-10,12-13H,4-7,11,14H2,1-3H3,(H3,23,24,25,26) |
| InChIKey | NUZGJYNMDQPVHA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|