About ethyl 4-methoxy-2,6-dimethylpyrimidine-5-carboxylate
ethyl 4-methoxy-2,6-dimethylpyrimidine-5-carboxylate (PubChem CID 151266109) has the molecular formula C10H14N2O3
and a molecular weight of 210.23 g/mol. Its IUPAC name is ethyl 4-methoxy-2,6-dimethylpyrimidine-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-methoxy-2,6-dimethylpyrimidine-5-carboxylate |
| PubChem CID | 151266109 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | ethyl 4-methoxy-2,6-dimethylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1c(C)nc(C)nc1OC |
| InChI | InChI=1S/C10H14N2O3/c1-5-15-10(13)8-6(2)11-7(3)12-9(8)14-4/h5H2,1-4H3 |
| InChIKey | NVJNOOGHYVCGCF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 4-methoxy-2,6-dimethylpyrimidine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-methoxy-2,6-dimethylpyrimidine-5-carboxylate?
The IUPAC name of ethyl 4-methoxy-2,6-dimethylpyrimidine-5-carboxylate (CID 151266109) is ethyl 4-methoxy-2,6-dimethylpyrimidine-5-carboxylate.
What is the SMILES notation for ethyl 4-methoxy-2,6-dimethylpyrimidine-5-carboxylate?
The canonical SMILES for ethyl 4-methoxy-2,6-dimethylpyrimidine-5-carboxylate is CCOC(=O)c1c(C)nc(C)nc1OC.
What is the InChIKey of ethyl 4-methoxy-2,6-dimethylpyrimidine-5-carboxylate?
The InChIKey is NVJNOOGHYVCGCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O3/c1-5-15-10(13)8-6(2)11-7(3)12-9(8)14-4/h5H2,1-4H3.
What are the key properties of ethyl 4-methoxy-2,6-dimethylpyrimidine-5-carboxylate?
ethyl 4-methoxy-2,6-dimethylpyrimidine-5-carboxylate has a molecular weight of 210.23 g/mol, XLogP of 1.28, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-methoxy-2,6-dimethylpyrimidine-5-carboxylate is sourced from PubChem (CID 151266109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).