C23H25N3O6S — CID 151267832
2-[6-[[4-[(1,1-dioxo-1,4-thiazinan-4-yl)iminomethyl]benzoyl]amino]-3,4-dihydro-2H-chromen-3-yl]acetic acid (PubChem CID 151267832) has the molecular formula C23H25N3O6S and a molecular weight of 471.54 g/mol. Its IUPAC name is 2-[6-[[4-[(1,1-dioxo-1,4-thiazinan-4-yl)iminomethyl]benzoyl]amino]-3,4-dihydro-2H-chromen-3-yl]acetic acid.
| Compound Name | 2-[6-[[4-[(1,1-dioxo-1,4-thiazinan-4-yl)iminomethyl]benzoyl]amino]-3,4-dihydro-2H-chromen-3-yl]acetic acid |
|---|---|
| PubChem CID | 151267832 |
| Molecular Formula | C23H25N3O6S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 2-[6-[[4-[(1,1-dioxo-1,4-thiazinan-4-yl)iminomethyl]benzoyl]amino]-3,4-dihydro-2H-chromen-3-yl]acetic acid |
| SMILES | O=C(O)CC1COc2ccc(NC(=O)c3ccc(C=NN4CCS(=O)(=O)CC4)cc3)cc2C1 |
| InChI | InChI=1S/C23H25N3O6S/c27-22(28)12-17-11-19-13-20(5-6-21(19)32-15-17)25-23(29)18-3-1-16(2-4-18)14-24-26-7-9-33(30,31)10-8-26/h1-6,13-14,17H,7-12,15H2,(H,25,29)(H,27,28) |
| InChIKey | NVSHYRAMSYCKKQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 125.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|