About 6-bromo-1-[11-methyl-10,10-di(propan-2-yl)dodecyl]indole
6-bromo-1-[11-methyl-10,10-di(propan-2-yl)dodecyl]indole (PubChem CID 151276834) has the molecular formula C27H44BrN
and a molecular weight of 462.56 g/mol. Its IUPAC name is 6-bromo-1-[11-methyl-10,10-di(propan-2-yl)dodecyl]indole.
Molecular Properties
| Compound Name | 6-bromo-1-[11-methyl-10,10-di(propan-2-yl)dodecyl]indole |
| PubChem CID | 151276834 |
| Molecular Formula | C27H44BrN |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 461.27 |
| IUPAC Name | 6-bromo-1-[11-methyl-10,10-di(propan-2-yl)dodecyl]indole |
| SMILES | CC(C)C(CCCCCCCCCn1ccc2ccc(Br)cc21)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H44BrN/c1-21(2)27(22(3)4,23(5)6)17-12-10-8-7-9-11-13-18-29-19-16-24-14-15-25(28)20-26(24)29/h14-16,19-23H,7-13,17-18H2,1-6H3 |
| InChIKey | NXNKNOZUKAUGAK-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-1-[11-methyl-10,10-di(propan-2-yl)dodecyl]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1-[11-methyl-10,10-di(propan-2-yl)dodecyl]indole?
The IUPAC name of 6-bromo-1-[11-methyl-10,10-di(propan-2-yl)dodecyl]indole (CID 151276834) is 6-bromo-1-[11-methyl-10,10-di(propan-2-yl)dodecyl]indole.
What is the SMILES notation for 6-bromo-1-[11-methyl-10,10-di(propan-2-yl)dodecyl]indole?
The canonical SMILES for 6-bromo-1-[11-methyl-10,10-di(propan-2-yl)dodecyl]indole is CC(C)C(CCCCCCCCCn1ccc2ccc(Br)cc21)(C(C)C)C(C)C.
What is the InChIKey of 6-bromo-1-[11-methyl-10,10-di(propan-2-yl)dodecyl]indole?
The InChIKey is NXNKNOZUKAUGAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H44BrN/c1-21(2)27(22(3)4,23(5)6)17-12-10-8-7-9-11-13-18-29-19-16-24-14-15-25(28)20-26(24)29/h14-16,19-23H,7-13,17-18H2,1-6H3.
What are the key properties of 6-bromo-1-[11-methyl-10,10-di(propan-2-yl)dodecyl]indole?
6-bromo-1-[11-methyl-10,10-di(propan-2-yl)dodecyl]indole has a molecular weight of 462.56 g/mol, XLogP of 9.48, 13 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1-[11-methyl-10,10-di(propan-2-yl)dodecyl]indole is sourced from PubChem (CID 151276834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).