C18H13F4NO2 — CID 151277815
3,4-bis[4-(difluoromethoxy)phenyl]-1H-pyrrole (PubChem CID 151277815) has the molecular formula C18H13F4NO2 and a molecular weight of 351.30 g/mol. Its IUPAC name is 3,4-bis[4-(difluoromethoxy)phenyl]-1H-pyrrole.
| Compound Name | 3,4-bis[4-(difluoromethoxy)phenyl]-1H-pyrrole |
|---|---|
| PubChem CID | 151277815 |
| Molecular Formula | C18H13F4NO2 |
| Molecular Weight | 351.30 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 3,4-bis[4-(difluoromethoxy)phenyl]-1H-pyrrole |
| SMILES | FC(F)Oc1ccc(-c2c[nH]cc2-c2ccc(OC(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H13F4NO2/c19-17(20)24-13-5-1-11(2-6-13)15-9-23-10-16(15)12-3-7-14(8-4-12)25-18(21)22/h1-10,17-18,23H |
| InChIKey | NXSLVWDWKJGUGQ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.30 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |