C17H23ClN2O2+2 — CID 15127950
(1,3-dimethyl-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-yl) 4-chlorobenzoate (PubChem CID 15127950) has the molecular formula C17H23ClN2O2+2 and a molecular weight of 322.84 g/mol. Its IUPAC name is (1,3-dimethyl-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-yl) 4-chlorobenzoate.
| Compound Name | (1,3-dimethyl-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-yl) 4-chlorobenzoate |
|---|---|
| PubChem CID | 15127950 |
| Molecular Formula | C17H23ClN2O2+2 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | (1,3-dimethyl-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-yl) 4-chlorobenzoate |
| SMILES | C[N+]12CC3C[N+](C)(CC(C1)C3OC(=O)c1ccc(Cl)cc1)C2 |
| InChI | InChI=1S/C17H23ClN2O2/c1-19-7-13-9-20(2,11-19)10-14(8-19)16(13)22-17(21)12-3-5-15(18)6-4-12/h3-6,13-14,16H,7-11H2,1-2H3/q+2 |
| InChIKey | JAHIFWRQINDXJO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|