About N'-ethyl-N'-methyl-N-propylprop-2-enehydrazide
N'-ethyl-N'-methyl-N-propylprop-2-enehydrazide (PubChem CID 151279963) has the molecular formula C9H18N2O
and a molecular weight of 170.26 g/mol. Its IUPAC name is N'-ethyl-N'-methyl-N-propylprop-2-enehydrazide.
Molecular Properties
| Compound Name | N'-ethyl-N'-methyl-N-propylprop-2-enehydrazide |
| PubChem CID | 151279963 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | N'-ethyl-N'-methyl-N-propylprop-2-enehydrazide |
| SMILES | C=CC(=O)N(CCC)N(C)CC |
| InChI | InChI=1S/C9H18N2O/c1-5-8-11(9(12)6-2)10(4)7-3/h6H,2,5,7-8H2,1,3-4H3 |
| InChIKey | NYDYFXMHJVVYNW-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-ethyl-N'-methyl-N-propylprop-2-enehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethyl-N'-methyl-N-propylprop-2-enehydrazide?
The IUPAC name of N'-ethyl-N'-methyl-N-propylprop-2-enehydrazide (CID 151279963) is N'-ethyl-N'-methyl-N-propylprop-2-enehydrazide.
What is the SMILES notation for N'-ethyl-N'-methyl-N-propylprop-2-enehydrazide?
The canonical SMILES for N'-ethyl-N'-methyl-N-propylprop-2-enehydrazide is C=CC(=O)N(CCC)N(C)CC.
What is the InChIKey of N'-ethyl-N'-methyl-N-propylprop-2-enehydrazide?
The InChIKey is NYDYFXMHJVVYNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O/c1-5-8-11(9(12)6-2)10(4)7-3/h6H,2,5,7-8H2,1,3-4H3.
What are the key properties of N'-ethyl-N'-methyl-N-propylprop-2-enehydrazide?
N'-ethyl-N'-methyl-N-propylprop-2-enehydrazide has a molecular weight of 170.26 g/mol, XLogP of 1.28, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethyl-N'-methyl-N-propylprop-2-enehydrazide is sourced from PubChem (CID 151279963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).