About methyl 2-(2,4-dioxopyrimidin-1-yl)acetate
methyl 2-(2,4-dioxopyrimidin-1-yl)acetate (PubChem CID 15128034) has the molecular formula C7H8N2O4
and a molecular weight of 184.15 g/mol. Its IUPAC name is methyl 2-(2,4-dioxopyrimidin-1-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-(2,4-dioxopyrimidin-1-yl)acetate |
| PubChem CID | 15128034 |
| Molecular Formula | C7H8N2O4 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | methyl 2-(2,4-dioxopyrimidin-1-yl)acetate |
| SMILES | COC(=O)Cn1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C7H8N2O4/c1-13-6(11)4-9-3-2-5(10)8-7(9)12/h2-3H,4H2,1H3,(H,8,10,12) |
| InChIKey | OGHZJZXUVUBFNI-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-(2,4-dioxopyrimidin-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(2,4-dioxopyrimidin-1-yl)acetate?
The IUPAC name of methyl 2-(2,4-dioxopyrimidin-1-yl)acetate (CID 15128034) is methyl 2-(2,4-dioxopyrimidin-1-yl)acetate.
What is the SMILES notation for methyl 2-(2,4-dioxopyrimidin-1-yl)acetate?
The canonical SMILES for methyl 2-(2,4-dioxopyrimidin-1-yl)acetate is COC(=O)Cn1ccc(=O)[nH]c1=O.
What is the InChIKey of methyl 2-(2,4-dioxopyrimidin-1-yl)acetate?
The InChIKey is OGHZJZXUVUBFNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O4/c1-13-6(11)4-9-3-2-5(10)8-7(9)12/h2-3H,4H2,1H3,(H,8,10,12).
What are the key properties of methyl 2-(2,4-dioxopyrimidin-1-yl)acetate?
methyl 2-(2,4-dioxopyrimidin-1-yl)acetate has a molecular weight of 184.15 g/mol, XLogP of -1.29, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,4-dioxopyrimidin-1-yl)acetate is sourced from PubChem (CID 15128034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).