C10H12 — CID 15128067
1,2,6,7-tetrahydronaphthalene (PubChem CID 15128067) has the molecular formula C10H12 and a molecular weight of 132.21 g/mol. Its IUPAC name is 1,2,6,7-tetrahydronaphthalene.
| Compound Name | 1,2,6,7-tetrahydronaphthalene |
|---|---|
| PubChem CID | 15128067 |
| Molecular Formula | C10H12 |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | 1,2,6,7-tetrahydronaphthalene |
| SMILES | C1=CC2=CCCC=C2CC1 |
| InChI | InChI=1S/C10H12/c1-2-6-10-8-4-3-7-9(10)5-1/h1,5,7-8H,2-4,6H2 |
| InChIKey | KVFBOPXYALYXNM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |