C14H19N3 — CID 151286436
N-(4-methylcyclohexyl)-6H-pyrrolo[3,4-b]pyridin-4-amine (PubChem CID 151286436) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is N-(4-methylcyclohexyl)-6H-pyrrolo[3,4-b]pyridin-4-amine.
| Compound Name | N-(4-methylcyclohexyl)-6H-pyrrolo[3,4-b]pyridin-4-amine |
|---|---|
| PubChem CID | 151286436 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | N-(4-methylcyclohexyl)-6H-pyrrolo[3,4-b]pyridin-4-amine |
| SMILES | CC1CCC(Nc2ccnc3c[nH]cc23)CC1 |
| InChI | InChI=1S/C14H19N3/c1-10-2-4-11(5-3-10)17-13-6-7-16-14-9-15-8-12(13)14/h6-11,15,17H,2-5H2,1H3 |
| InChIKey | DAKUUJFKOMPILB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |