C22H16ClFN2 — CID 15128757
(2S,5S,6S)-6-(4-chlorophenyl)-2-(2-fluorophenyl)-4-phenyl-1,3-diazabicyclo[3.1.0]hex-3-ene (PubChem CID 15128757) has the molecular formula C22H16ClFN2 and a molecular weight of 362.84 g/mol. Its IUPAC name is (2S,5S,6S)-6-(4-chlorophenyl)-2-(2-fluorophenyl)-4-phenyl-1,3-diazabicyclo[3.1.0]hex-3-ene.
| Compound Name | (2S,5S,6S)-6-(4-chlorophenyl)-2-(2-fluorophenyl)-4-phenyl-1,3-diazabicyclo[3.1.0]hex-3-ene |
|---|---|
| PubChem CID | 15128757 |
| Molecular Formula | C22H16ClFN2 |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | (2S,5S,6S)-6-(4-chlorophenyl)-2-(2-fluorophenyl)-4-phenyl-1,3-diazabicyclo[3.1.0]hex-3-ene |
| SMILES | Fc1ccccc1[C@@H]1N=C(c2ccccc2)[C@@H]2[C@H](c3ccc(Cl)cc3)N21 |
| InChI | InChI=1S/C22H16ClFN2/c23-16-12-10-15(11-13-16)20-21-19(14-6-2-1-3-7-14)25-22(26(20)21)17-8-4-5-9-18(17)24/h1-13,20-22H/t20-,21+,22+,26?/m0/s1 |
| InChIKey | TWVYVKZRLPZUNO-FPEVGPDVSA-N |
| XLogP | 5.41 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|