C20H20F4N2 — CID 151289751
N-[5-cyclopropyl-2-methyl-2-(2,2,2-trifluoroethyl)pent-4-ynyl]-8-fluoroquinolin-3-amine (PubChem CID 151289751) has the molecular formula C20H20F4N2 and a molecular weight of 364.39 g/mol. Its IUPAC name is N-[5-cyclopropyl-2-methyl-2-(2,2,2-trifluoroethyl)pent-4-ynyl]-8-fluoroquinolin-3-amine.
| Compound Name | N-[5-cyclopropyl-2-methyl-2-(2,2,2-trifluoroethyl)pent-4-ynyl]-8-fluoroquinolin-3-amine |
|---|---|
| PubChem CID | 151289751 |
| Molecular Formula | C20H20F4N2 |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | N-[5-cyclopropyl-2-methyl-2-(2,2,2-trifluoroethyl)pent-4-ynyl]-8-fluoroquinolin-3-amine |
| SMILES | CC(CC#CC1CC1)(CNc1cnc2c(F)cccc2c1)CC(F)(F)F |
| InChI | InChI=1S/C20H20F4N2/c1-19(12-20(22,23)24,9-3-4-14-7-8-14)13-26-16-10-15-5-2-6-17(21)18(15)25-11-16/h2,5-6,10-11,14,26H,7-9,12-13H2,1H3 |
| InChIKey | AGMDZADBBLLPLQ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|