C35H42O12 — CID 151290014
[4-[(E)-2-[3,5-bis[[(2S,4R)-2,4-dimethyl-1,3-dioxane-2-carbonyl]oxy]phenyl]ethenyl]phenyl] (2S,4R)-2,4-dimethyl-1,3-dioxane-2-carboxylate (PubChem CID 151290014) has the molecular formula C35H42O12 and a molecular weight of 654.71 g/mol. Its IUPAC name is [4-[(E)-2-[3,5-bis[[(2S,4R)-2,4-dimethyl-1,3-dioxane-2-carbonyl]oxy]phenyl]ethenyl]phenyl] (2S,4R)-2,4-dimethyl-1,3-dioxane-2-carboxylate.
| Compound Name | [4-[(E)-2-[3,5-bis[[(2S,4R)-2,4-dimethyl-1,3-dioxane-2-carbonyl]oxy]phenyl]ethenyl]phenyl] (2S,4R)-2,4-dimethyl-1,3-dioxane-2-carboxylate |
|---|---|
| PubChem CID | 151290014 |
| Molecular Formula | C35H42O12 |
| Molecular Weight | 654.71 g/mol |
| Exact Mass | 654.27 |
| IUPAC Name | [4-[(E)-2-[3,5-bis[[(2S,4R)-2,4-dimethyl-1,3-dioxane-2-carbonyl]oxy]phenyl]ethenyl]phenyl] (2S,4R)-2,4-dimethyl-1,3-dioxane-2-carboxylate |
| SMILES | C[C@@H]1CCO[C@](C)(C(=O)Oc2ccc(/C=C/c3cc(OC(=O)[C@@]4(C)OCC[C@@H](C)O4)cc(OC(=O)[C@@]4(C)OCC[C@@H](C)O4)c3)cc2)O1 |
| InChI | InChI=1S/C35H42O12/c1-22-13-16-39-33(4,45-22)30(36)42-27-11-9-25(10-12-27)7-8-26-19-28(43-31(37)34(5)40-17-14-23(2)46-34)21-29(20-26)44-32(38)35(6)41-18-15-24(3)47-35/h7-12,19-24H,13-18H2,1-6H3/b8-7+/t22-,23-,24-,33+,34+,35+/m1/s1 |
| InChIKey | OAFRHJUJIWTYED-PXRKHKQPSA-N |
| XLogP | 5.20 |
| TPSA | 134.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.71 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|