About 2-(2-nitrophenyl)-1,4-dioxaspiro[4.4]nonane-3-carboxylic acid
2-(2-nitrophenyl)-1,4-dioxaspiro[4.4]nonane-3-carboxylic acid (PubChem CID 151291295) has the molecular formula C14H15NO6
and a molecular weight of 293.27 g/mol. Its IUPAC name is 2-(2-nitrophenyl)-1,4-dioxaspiro[4.4]nonane-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-(2-nitrophenyl)-1,4-dioxaspiro[4.4]nonane-3-carboxylic acid |
| PubChem CID | 151291295 |
| Molecular Formula | C14H15NO6 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 2-(2-nitrophenyl)-1,4-dioxaspiro[4.4]nonane-3-carboxylic acid |
| SMILES | O=C(O)C1OC2(CCCC2)OC1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H15NO6/c16-13(17)12-11(20-14(21-12)7-3-4-8-14)9-5-1-2-6-10(9)15(18)19/h1-2,5-6,11-12H,3-4,7-8H2,(H,16,17) |
| InChIKey | OAMBWLQRIFXYTQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-nitrophenyl)-1,4-dioxaspiro[4.4]nonane-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-nitrophenyl)-1,4-dioxaspiro[4.4]nonane-3-carboxylic acid?
The IUPAC name of 2-(2-nitrophenyl)-1,4-dioxaspiro[4.4]nonane-3-carboxylic acid (CID 151291295) is 2-(2-nitrophenyl)-1,4-dioxaspiro[4.4]nonane-3-carboxylic acid.
What is the SMILES notation for 2-(2-nitrophenyl)-1,4-dioxaspiro[4.4]nonane-3-carboxylic acid?
The canonical SMILES for 2-(2-nitrophenyl)-1,4-dioxaspiro[4.4]nonane-3-carboxylic acid is O=C(O)C1OC2(CCCC2)OC1c1ccccc1[N+](=O)[O-].
What is the InChIKey of 2-(2-nitrophenyl)-1,4-dioxaspiro[4.4]nonane-3-carboxylic acid?
The InChIKey is OAMBWLQRIFXYTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO6/c16-13(17)12-11(20-14(21-12)7-3-4-8-14)9-5-1-2-6-10(9)15(18)19/h1-2,5-6,11-12H,3-4,7-8H2,(H,16,17).
What are the key properties of 2-(2-nitrophenyl)-1,4-dioxaspiro[4.4]nonane-3-carboxylic acid?
2-(2-nitrophenyl)-1,4-dioxaspiro[4.4]nonane-3-carboxylic acid has a molecular weight of 293.27 g/mol, XLogP of 2.41, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-nitrophenyl)-1,4-dioxaspiro[4.4]nonane-3-carboxylic acid is sourced from PubChem (CID 151291295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).