C13H14F11I — CID 151295872
1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-(2-iodo-2-methylhexyl)cyclohexane (PubChem CID 151295872) has the molecular formula C13H14F11I and a molecular weight of 506.14 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-(2-iodo-2-methylhexyl)cyclohexane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-(2-iodo-2-methylhexyl)cyclohexane |
|---|---|
| PubChem CID | 151295872 |
| Molecular Formula | C13H14F11I |
| Molecular Weight | 506.14 g/mol |
| Exact Mass | 506.00 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-(2-iodo-2-methylhexyl)cyclohexane |
| SMILES | CCCCC(C)(I)CC1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C13H14F11I/c1-3-4-5-7(2,25)6-8(14)9(15,16)11(19,20)13(23,24)12(21,22)10(8,17)18/h3-6H2,1-2H3 |
| InChIKey | OBJWWPUCAKLMFP-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.14 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|